C8H11ClF3NO — CID 2781253
2-chloro-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one (PubChem CID 2781253) has the molecular formula C8H11ClF3NO and a molecular weight of 229.63 g/mol. Its IUPAC name is 2-chloro-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one.
| Compound Name | 2-chloro-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 2781253 |
| Molecular Formula | C8H11ClF3NO |
| Molecular Weight | 229.63 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-chloro-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one |
| SMILES | O=C(C(Cl)C(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C8H11ClF3NO/c9-6(8(10,11)12)7(14)13-4-2-1-3-5-13/h6H,1-5H2 |
| InChIKey | NWQXWYSHSAXLIU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.63 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|