C17H11F4NO5S — CID 2781498
ethyl 4,5,6,7-tetrafluoro-2-[(1-oxidopyridin-1-ium-2-yl)sulfinylmethyl]-1-benzofuran-3-carboxylate (PubChem CID 2781498) has the molecular formula C17H11F4NO5S and a molecular weight of 417.34 g/mol. Its IUPAC name is ethyl 4,5,6,7-tetrafluoro-2-[(1-oxidopyridin-1-ium-2-yl)sulfinylmethyl]-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 4,5,6,7-tetrafluoro-2-[(1-oxidopyridin-1-ium-2-yl)sulfinylmethyl]-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 2781498 |
| Molecular Formula | C17H11F4NO5S |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | ethyl 4,5,6,7-tetrafluoro-2-[(1-oxidopyridin-1-ium-2-yl)sulfinylmethyl]-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(CS(=O)c2cccc[n+]2[O-])oc2c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C17H11F4NO5S/c1-2-26-17(23)10-8(7-28(25)9-5-3-4-6-22(9)24)27-16-11(10)12(18)13(19)14(20)15(16)21/h3-6H,2,7H2,1H3 |
| InChIKey | XKLORINYMQPPGB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 83.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|