C13H8F4O4 — CID 660935
ethyl 5,6,7,8-tetrafluoro-2-methyl-4-oxochromene-3-carboxylate (PubChem CID 660935) has the molecular formula C13H8F4O4 and a molecular weight of 304.20 g/mol. Its IUPAC name is ethyl 5,6,7,8-tetrafluoro-2-methyl-4-oxochromene-3-carboxylate.
| Compound Name | ethyl 5,6,7,8-tetrafluoro-2-methyl-4-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 660935 |
| Molecular Formula | C13H8F4O4 |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | ethyl 5,6,7,8-tetrafluoro-2-methyl-4-oxochromene-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2c(F)c(F)c(F)c(F)c2c1=O |
| InChI | InChI=1S/C13H8F4O4/c1-3-20-13(19)5-4(2)21-12-6(11(5)18)7(14)8(15)9(16)10(12)17/h3H2,1-2H3 |
| InChIKey | APHVYXJZVANHDP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|