C13H10I2O4 — CID 11123720
ethyl 6,8-diiodo-2-methyl-4-oxochromene-3-carboxylate (PubChem CID 11123720) has the molecular formula C13H10I2O4 and a molecular weight of 484.03 g/mol. Its IUPAC name is ethyl 6,8-diiodo-2-methyl-4-oxochromene-3-carboxylate.
| Compound Name | ethyl 6,8-diiodo-2-methyl-4-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 11123720 |
| Molecular Formula | C13H10I2O4 |
| Molecular Weight | 484.03 g/mol |
| Exact Mass | 483.87 |
| IUPAC Name | ethyl 6,8-diiodo-2-methyl-4-oxochromene-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2c(I)cc(I)cc2c1=O |
| InChI | InChI=1S/C13H10I2O4/c1-3-18-13(17)10-6(2)19-12-8(11(10)16)4-7(14)5-9(12)15/h4-5H,3H2,1-2H3 |
| InChIKey | DUIYBNDMISEKAZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.03 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|