C17H18O6 — CID 102318443
diethyl 3-(4-hydroxyphenyl)-5-methylfuran-2,4-dicarboxylate (PubChem CID 102318443) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is diethyl 3-(4-hydroxyphenyl)-5-methylfuran-2,4-dicarboxylate.
| Compound Name | diethyl 3-(4-hydroxyphenyl)-5-methylfuran-2,4-dicarboxylate |
|---|---|
| PubChem CID | 102318443 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | diethyl 3-(4-hydroxyphenyl)-5-methylfuran-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1oc(C)c(C(=O)OCC)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C17H18O6/c1-4-21-16(19)13-10(3)23-15(17(20)22-5-2)14(13)11-6-8-12(18)9-7-11/h6-9,18H,4-5H2,1-3H3 |
| InChIKey | MNFCLZPHJFCSHS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |