C14H11F4NO4 — CID 166244589
[3-hydroxy-3-(hydroxymethyl)azetidin-1-yl]-(4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-yl)methanone (PubChem CID 166244589) has the molecular formula C14H11F4NO4 and a molecular weight of 333.24 g/mol. Its IUPAC name is [3-hydroxy-3-(hydroxymethyl)azetidin-1-yl]-(4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-yl)methanone.
| Compound Name | [3-hydroxy-3-(hydroxymethyl)azetidin-1-yl]-(4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-yl)methanone |
|---|---|
| PubChem CID | 166244589 |
| Molecular Formula | C14H11F4NO4 |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | [3-hydroxy-3-(hydroxymethyl)azetidin-1-yl]-(4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-yl)methanone |
| SMILES | Cc1oc2c(F)c(F)c(F)c(F)c2c1C(=O)N1CC(O)(CO)C1 |
| InChI | InChI=1S/C14H11F4NO4/c1-5-6(13(21)19-2-14(22,3-19)4-20)7-8(15)9(16)10(17)11(18)12(7)23-5/h20,22H,2-4H2,1H3 |
| InChIKey | SFFPUCQXEJEZEE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|