C17H18F4N2O4 — CID 97222387
4,5,6,7-tetrafluoro-N-[(2R)-2-hydroxy-3-morpholin-4-ylpropyl]-2-methyl-1-benzofuran-3-carboxamide (PubChem CID 97222387) has the molecular formula C17H18F4N2O4 and a molecular weight of 390.33 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-N-[(2R)-2-hydroxy-3-morpholin-4-ylpropyl]-2-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 4,5,6,7-tetrafluoro-N-[(2R)-2-hydroxy-3-morpholin-4-ylpropyl]-2-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 97222387 |
| Molecular Formula | C17H18F4N2O4 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4,5,6,7-tetrafluoro-N-[(2R)-2-hydroxy-3-morpholin-4-ylpropyl]-2-methyl-1-benzofuran-3-carboxamide |
| SMILES | Cc1oc2c(F)c(F)c(F)c(F)c2c1C(=O)NC[C@@H](O)CN1CCOCC1 |
| InChI | InChI=1S/C17H18F4N2O4/c1-8-10(11-12(18)13(19)14(20)15(21)16(11)27-8)17(25)22-6-9(24)7-23-2-4-26-5-3-23/h9,24H,2-7H2,1H3,(H,22,25)/t9-/m1/s1 |
| InChIKey | LYMAMJAGYRLXIQ-SECBINFHSA-N |
| XLogP | 1.72 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|