C23H25N2O3PS — CID 2781520
1-(1-diphenoxyphosphorylethyl)-3-(2-phenylethyl)thiourea (PubChem CID 2781520) has the molecular formula C23H25N2O3PS and a molecular weight of 440.50 g/mol. Its IUPAC name is 1-(1-diphenoxyphosphorylethyl)-3-(2-phenylethyl)thiourea.
| Compound Name | 1-(1-diphenoxyphosphorylethyl)-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 2781520 |
| Molecular Formula | C23H25N2O3PS |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 1-(1-diphenoxyphosphorylethyl)-3-(2-phenylethyl)thiourea |
| SMILES | CC(NC(=S)NCCc1ccccc1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C23H25N2O3PS/c1-19(25-23(30)24-18-17-20-11-5-2-6-12-20)29(26,27-21-13-7-3-8-14-21)28-22-15-9-4-10-16-22/h2-16,19H,17-18H2,1H3,(H2,24,25,30) |
| InChIKey | DKLKYCAQHYHOSF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|