C18H18O4 — CID 27818254
3-hydroxy-1,3-bis(3-methoxyphenyl)-2-methylprop-2-en-1-one (PubChem CID 27818254) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-hydroxy-1,3-bis(3-methoxyphenyl)-2-methylprop-2-en-1-one.
| Compound Name | 3-hydroxy-1,3-bis(3-methoxyphenyl)-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 27818254 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-hydroxy-1,3-bis(3-methoxyphenyl)-2-methylprop-2-en-1-one |
| SMILES | COc1cccc(C(=O)C(C)=C(O)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C18H18O4/c1-12(17(19)13-6-4-8-15(10-13)21-2)18(20)14-7-5-9-16(11-14)22-3/h4-11,19H,1-3H3 |
| InChIKey | VTFDOQOXBAGXFV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|