C21H23BrN2O2 — CID 2782259
N-[4-[(2-benzyl-7-bromo-2-azabicyclo[2.2.1]heptan-6-yl)oxy]phenyl]acetamide (PubChem CID 2782259) has the molecular formula C21H23BrN2O2 and a molecular weight of 415.33 g/mol. Its IUPAC name is N-[4-[(2-benzyl-7-bromo-2-azabicyclo[2.2.1]heptan-6-yl)oxy]phenyl]acetamide.
| Compound Name | N-[4-[(2-benzyl-7-bromo-2-azabicyclo[2.2.1]heptan-6-yl)oxy]phenyl]acetamide |
|---|---|
| PubChem CID | 2782259 |
| Molecular Formula | C21H23BrN2O2 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | N-[4-[(2-benzyl-7-bromo-2-azabicyclo[2.2.1]heptan-6-yl)oxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(OC2CC3CN(Cc4ccccc4)C2C3Br)cc1 |
| InChI | InChI=1S/C21H23BrN2O2/c1-14(25)23-17-7-9-18(10-8-17)26-19-11-16-13-24(21(19)20(16)22)12-15-5-3-2-4-6-15/h2-10,16,19-21H,11-13H2,1H3,(H,23,25) |
| InChIKey | VXNDOXHKVDFNME-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|