About Diphenyl(naphthyl)sulphonium triflate
Diphenyl(naphthyl)sulphonium triflate (PubChem CID 2782342) has the molecular formula C23H17F3O3S2
and a molecular weight of 462.50 g/mol. Its IUPAC name is [naphthalen-1-yl(diphenyl)-lambda4-sulfanyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | Diphenyl(naphthyl)sulphonium triflate |
| PubChem CID | 2782342 |
| Molecular Formula | C23H17F3O3S2 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | [naphthalen-1-yl(diphenyl)-lambda4-sulfanyl] trifluoromethanesulfonate |
| SMILES | C1=CC=C(C=C1)S(C2=CC=CC=C2)(C3=CC=CC4=CC=CC=C43)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C23H17F3O3S2/c24-23(25,26)31(27,28)29-30(19-12-3-1-4-13-19,20-14-5-2-6-15-20)22-17-9-11-18-10-7-8-16-21(18)22/h1-17H |
| InChIKey | VJBTYKFEWUVBFJ-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 52.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | 674 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze Diphenyl(naphthyl)sulphonium triflate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diphenyl(naphthyl)sulphonium triflate?
The IUPAC name of Diphenyl(naphthyl)sulphonium triflate (CID 2782342) is [naphthalen-1-yl(diphenyl)-lambda4-sulfanyl] trifluoromethanesulfonate.
What is the SMILES notation for Diphenyl(naphthyl)sulphonium triflate?
The canonical SMILES for Diphenyl(naphthyl)sulphonium triflate is C1=CC=C(C=C1)S(C2=CC=CC=C2)(C3=CC=CC4=CC=CC=C43)OS(=O)(=O)C(F)(F)F.
What is the InChIKey of Diphenyl(naphthyl)sulphonium triflate?
The InChIKey is VJBTYKFEWUVBFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17F3O3S2/c24-23(25,26)31(27,28)29-30(19-12-3-1-4-13-19,20-14-5-2-6-15-20)22-17-9-11-18-10-7-8-16-21(18)22/h1-17H.
What are the key properties of Diphenyl(naphthyl)sulphonium triflate?
Diphenyl(naphthyl)sulphonium triflate has a molecular weight of 462.50 g/mol, XLogP of 7.70, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Diphenyl(naphthyl)sulphonium triflate is sourced from PubChem (CID 2782342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).