C19H18N2O2 — CID 27825940
1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]pyrrolidin-2-one (PubChem CID 27825940) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]pyrrolidin-2-one.
| Compound Name | 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 27825940 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1cccc(C(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C19H18N2O2/c22-18-9-4-11-20(18)16-7-3-6-15(13-16)19(23)21-12-10-14-5-1-2-8-17(14)21/h1-3,5-8,13H,4,9-12H2 |
| InChIKey | IVEQMBFKPHBIRP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |