C26H25N3O2 — CID 50814325
1-benzyl-3-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-1,3-diazinan-2-one (PubChem CID 50814325) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-benzyl-3-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-1,3-diazinan-2-one.
| Compound Name | 1-benzyl-3-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 50814325 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 1-benzyl-3-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-1,3-diazinan-2-one |
| SMILES | O=C1N(Cc2ccccc2)CCCN1c1cccc(C(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C26H25N3O2/c30-25(29-17-14-21-10-4-5-13-24(21)29)22-11-6-12-23(18-22)28-16-7-15-27(26(28)31)19-20-8-2-1-3-9-20/h1-6,8-13,18H,7,14-17,19H2 |
| InChIKey | JDIMPEXZFHRZKW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |