C20H20ClN3O2S — CID 27828864
3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(3-phenylsulfanylpropyl)propanamide (PubChem CID 27828864) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(3-phenylsulfanylpropyl)propanamide.
| Compound Name | 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(3-phenylsulfanylpropyl)propanamide |
|---|---|
| PubChem CID | 27828864 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(3-phenylsulfanylpropyl)propanamide |
| SMILES | O=C(CCc1nc(-c2ccc(Cl)cc2)no1)NCCCSc1ccccc1 |
| InChI | InChI=1S/C20H20ClN3O2S/c21-16-9-7-15(8-10-16)20-23-19(26-24-20)12-11-18(25)22-13-4-14-27-17-5-2-1-3-6-17/h1-3,5-10H,4,11-14H2,(H,22,25) |
| InChIKey | GJLGRWQTYBRNJN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|