C18H19ClN2O2S — CID 27830091
N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 27830091) has the molecular formula C18H19ClN2O2S and a molecular weight of 362.88 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 27830091 |
| Molecular Formula | C18H19ClN2O2S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C18H19ClN2O2S/c1-2-20(12-15-8-9-16(19)24-15)18(23)13-5-3-6-14(11-13)21-10-4-7-17(21)22/h3,5-6,8-9,11H,2,4,7,10,12H2,1H3 |
| InChIKey | CLIFBOQPVOPRCC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |