C14H11Cl2N5O3S2 — CID 27831989
N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide (PubChem CID 27831989) has the molecular formula C14H11Cl2N5O3S2 and a molecular weight of 432.31 g/mol. Its IUPAC name is N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 27831989 |
| Molecular Formula | C14H11Cl2N5O3S2 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 430.97 |
| IUPAC Name | N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
| SMILES | Cc1nn(CC(=O)Nc2nc(-c3cc(Cl)sc3Cl)cs2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11Cl2N5O3S2/c1-6-12(21(23)24)7(2)20(19-6)4-11(22)18-14-17-9(5-25-14)8-3-10(15)26-13(8)16/h3,5H,4H2,1-2H3,(H,17,18,22) |
| InChIKey | MGWWBGXBIDRNSD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|