C23H19N2O2+ — CID 2783616
5-benzyl-6-hydroxy-1,3-diphenylpyrimidin-1-ium-4-one (PubChem CID 2783616) has the molecular formula C23H19N2O2+ and a molecular weight of 355.42 g/mol. Its IUPAC name is 5-benzyl-6-hydroxy-1,3-diphenylpyrimidin-1-ium-4-one.
| Compound Name | 5-benzyl-6-hydroxy-1,3-diphenylpyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 2783616 |
| Molecular Formula | C23H19N2O2+ |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 5-benzyl-6-hydroxy-1,3-diphenylpyrimidin-1-ium-4-one |
| SMILES | O=c1c(Cc2ccccc2)c(O)[n+](-c2ccccc2)cn1-c1ccccc1 |
| InChI | InChI=1S/C23H18N2O2/c26-22-21(16-18-10-4-1-5-11-18)23(27)25(20-14-8-3-9-15-20)17-24(22)19-12-6-2-7-13-19/h1-15,17H,16H2/p+1 |
| InChIKey | KJQIUKFMQJMLAV-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 46.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|