C26H19N3O3S — CID 27845144
N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-cyanophenyl)benzamide (PubChem CID 27845144) has the molecular formula C26H19N3O3S and a molecular weight of 453.52 g/mol. Its IUPAC name is N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-cyanophenyl)benzamide.
| Compound Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-cyanophenyl)benzamide |
|---|---|
| PubChem CID | 27845144 |
| Molecular Formula | C26H19N3O3S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-cyanophenyl)benzamide |
| SMILES | N#Cc1ccccc1-c1ccccc1C(=O)NCCN1C(=O)S/C(=C\c2ccccc2)C1=O |
| InChI | InChI=1S/C26H19N3O3S/c27-17-19-10-4-5-11-20(19)21-12-6-7-13-22(21)24(30)28-14-15-29-25(31)23(33-26(29)32)16-18-8-2-1-3-9-18/h1-13,16H,14-15H2,(H,28,30)/b23-16- |
| InChIKey | VTRFRDGRKKLMBB-KQWNVCNZSA-N |
| XLogP | 4.69 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|