C23H19N3O4 — CID 27878263
2-[(4S)-3,5-dioxo-2-phenyl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-4-yl]benzoic acid (PubChem CID 27878263) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-[(4S)-3,5-dioxo-2-phenyl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-4-yl]benzoic acid.
| Compound Name | 2-[(4S)-3,5-dioxo-2-phenyl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 27878263 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-[(4S)-3,5-dioxo-2-phenyl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-4-yl]benzoic acid |
| SMILES | O=C1CCCC2=C1[C@H](c1ccccc1C(=O)O)c1c([nH]n(-c3ccccc3)c1=O)N2 |
| InChI | InChI=1S/C23H19N3O4/c27-17-12-6-11-16-19(17)18(14-9-4-5-10-15(14)23(29)30)20-21(24-16)25-26(22(20)28)13-7-2-1-3-8-13/h1-5,7-10,18,24-25H,6,11-12H2,(H,29,30)/t18-/m0/s1 |
| InChIKey | VECGPLMZOPYZOB-SFHVURJKSA-N |
| XLogP | 3.43 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |