C24H21N3O4 — CID 2951529
methyl 4-(3,5-dioxo-2-phenyl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-4-yl)benzoate (PubChem CID 2951529) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is methyl 4-(3,5-dioxo-2-phenyl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-4-yl)benzoate.
| Compound Name | methyl 4-(3,5-dioxo-2-phenyl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-4-yl)benzoate |
|---|---|
| PubChem CID | 2951529 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | methyl 4-(3,5-dioxo-2-phenyl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-4-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2C3=C(CCCC3=O)Nc3[nH]n(-c4ccccc4)c(=O)c32)cc1 |
| InChI | InChI=1S/C24H21N3O4/c1-31-24(30)15-12-10-14(11-13-15)19-20-17(8-5-9-18(20)28)25-22-21(19)23(29)27(26-22)16-6-3-2-4-7-16/h2-4,6-7,10-13,19,25-26H,5,8-9H2,1H3 |
| InChIKey | KAGUTTGKQLYIKG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |