C26H25N3O6 — CID 27880446
methyl 4-[(2R)-3-[hydroxy-(4-methoxyphenyl)methylidene]-1-(3-imidazol-1-ylpropyl)-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 27880446) has the molecular formula C26H25N3O6 and a molecular weight of 475.50 g/mol. Its IUPAC name is methyl 4-[(2R)-3-[hydroxy-(4-methoxyphenyl)methylidene]-1-(3-imidazol-1-ylpropyl)-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2R)-3-[hydroxy-(4-methoxyphenyl)methylidene]-1-(3-imidazol-1-ylpropyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 27880446 |
| Molecular Formula | C26H25N3O6 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | methyl 4-[(2R)-3-[hydroxy-(4-methoxyphenyl)methylidene]-1-(3-imidazol-1-ylpropyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2C(=C(O)c3ccc(OC)cc3)C(=O)C(=O)N2CCCn2ccnc2)cc1 |
| InChI | InChI=1S/C26H25N3O6/c1-34-20-10-8-18(9-11-20)23(30)21-22(17-4-6-19(7-5-17)26(33)35-2)29(25(32)24(21)31)14-3-13-28-15-12-27-16-28/h4-12,15-16,22,30H,3,13-14H2,1-2H3/t22-/m1/s1 |
| InChIKey | JRFCBSYTMHFBTQ-JOCHJYFZSA-N |
| XLogP | 3.19 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|