C23H23NO7 — CID 51855467
methyl 4-[(2S)-3-[hydroxy-(4-methoxyphenyl)methylidene]-1-(3-hydroxypropyl)-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 51855467) has the molecular formula C23H23NO7 and a molecular weight of 425.44 g/mol. Its IUPAC name is methyl 4-[(2S)-3-[hydroxy-(4-methoxyphenyl)methylidene]-1-(3-hydroxypropyl)-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2S)-3-[hydroxy-(4-methoxyphenyl)methylidene]-1-(3-hydroxypropyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 51855467 |
| Molecular Formula | C23H23NO7 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | methyl 4-[(2S)-3-[hydroxy-(4-methoxyphenyl)methylidene]-1-(3-hydroxypropyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C(=C(O)c3ccc(OC)cc3)C(=O)C(=O)N2CCCO)cc1 |
| InChI | InChI=1S/C23H23NO7/c1-30-17-10-8-15(9-11-17)20(26)18-19(24(12-3-13-25)22(28)21(18)27)14-4-6-16(7-5-14)23(29)31-2/h4-11,19,25-26H,3,12-13H2,1-2H3/t19-/m0/s1 |
| InChIKey | SFYHVEYTRAKNRR-IBGZPJMESA-N |
| XLogP | 2.29 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|