C18H11N3O3S — CID 27882256
(2R)-2-thiophen-3-yl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-4,6,17-trione (PubChem CID 27882256) has the molecular formula C18H11N3O3S and a molecular weight of 349.37 g/mol. Its IUPAC name is (2R)-2-thiophen-3-yl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-4,6,17-trione.
| Compound Name | (2R)-2-thiophen-3-yl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-4,6,17-trione |
|---|---|
| PubChem CID | 27882256 |
| Molecular Formula | C18H11N3O3S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | (2R)-2-thiophen-3-yl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-4,6,17-trione |
| SMILES | O=C1C2=C(Nc3[nH]c(=O)[nH]c(=O)c3[C@@H]2c2ccsc2)c2ccccc21 |
| InChI | InChI=1S/C18H11N3O3S/c22-15-10-4-2-1-3-9(10)14-12(15)11(8-5-6-25-7-8)13-16(19-14)20-18(24)21-17(13)23/h1-7,11H,(H3,19,20,21,23,24)/t11-/m1/s1 |
| InChIKey | DDYLNPMYXUJLLG-LLVKDONJSA-N |
| XLogP | 2.29 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |