C20H13ClN4O2 — CID 135524250
6-amino-2-(4-chlorophenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione (PubChem CID 135524250) has the molecular formula C20H13ClN4O2 and a molecular weight of 376.80 g/mol. Its IUPAC name is 6-amino-2-(4-chlorophenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione.
| Compound Name | 6-amino-2-(4-chlorophenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione |
|---|---|
| PubChem CID | 135524250 |
| Molecular Formula | C20H13ClN4O2 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 6-amino-2-(4-chlorophenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione |
| SMILES | Nc1nc2c(c(=O)[nH]1)C(c1ccc(Cl)cc1)C1=C(N2)c2ccccc2C1=O |
| InChI | InChI=1S/C20H13ClN4O2/c21-10-7-5-9(6-8-10)13-14-16(11-3-1-2-4-12(11)17(14)26)23-18-15(13)19(27)25-20(22)24-18/h1-8,13H,(H4,22,23,24,25,27) |
| InChIKey | JATWJDVZDIBCQO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |