C23H18N4O3 — CID 135622827
(2R)-6-amino-2-(2-prop-2-enoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione (PubChem CID 135622827) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is (2R)-6-amino-2-(2-prop-2-enoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione.
| Compound Name | (2R)-6-amino-2-(2-prop-2-enoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione |
|---|---|
| PubChem CID | 135622827 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (2R)-6-amino-2-(2-prop-2-enoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione |
| SMILES | C=CCOc1ccccc1[C@@H]1C2=C(Nc3nc(N)[nH]c(=O)c31)c1ccccc1C2=O |
| InChI | InChI=1S/C23H18N4O3/c1-2-11-30-15-10-6-5-9-14(15)16-17-19(12-7-3-4-8-13(12)20(17)28)25-21-18(16)22(29)27-23(24)26-21/h2-10,16H,1,11H2,(H4,24,25,26,27,29)/t16-/m1/s1 |
| InChIKey | BWVUZAXEULFEBT-MRXNPFEDSA-N |
| XLogP | 3.08 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|