C20H12Cl2N4O2 — CID 135524268
6-amino-2-(2,4-dichlorophenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione (PubChem CID 135524268) has the molecular formula C20H12Cl2N4O2 and a molecular weight of 411.25 g/mol. Its IUPAC name is 6-amino-2-(2,4-dichlorophenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione.
| Compound Name | 6-amino-2-(2,4-dichlorophenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione |
|---|---|
| PubChem CID | 135524268 |
| Molecular Formula | C20H12Cl2N4O2 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 6-amino-2-(2,4-dichlorophenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione |
| SMILES | Nc1nc2c(c(=O)[nH]1)C(c1ccc(Cl)cc1Cl)C1=C(N2)c2ccccc2C1=O |
| InChI | InChI=1S/C20H12Cl2N4O2/c21-8-5-6-11(12(22)7-8)13-14-16(9-3-1-2-4-10(9)17(14)27)24-18-15(13)19(28)26-20(23)25-18/h1-7,13H,(H4,23,24,25,26,28) |
| InChIKey | CVJRLRSJOKMVTN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |