C19H9Cl2F3N4O — CID 2098054
(10S)-10-(2,4-dichlorophenyl)-13-(trifluoromethyl)-11,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaen-8-one (PubChem CID 2098054) has the molecular formula C19H9Cl2F3N4O and a molecular weight of 437.21 g/mol. Its IUPAC name is (10S)-10-(2,4-dichlorophenyl)-13-(trifluoromethyl)-11,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaen-8-one.
| Compound Name | (10S)-10-(2,4-dichlorophenyl)-13-(trifluoromethyl)-11,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaen-8-one |
|---|---|
| PubChem CID | 2098054 |
| Molecular Formula | C19H9Cl2F3N4O |
| Molecular Weight | 437.21 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | (10S)-10-(2,4-dichlorophenyl)-13-(trifluoromethyl)-11,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaen-8-one |
| SMILES | O=C1C2=C(Nc3nc(C(F)(F)F)nn3[C@@H]2c2ccc(Cl)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C19H9Cl2F3N4O/c20-8-5-6-11(12(21)7-8)15-13-14(9-3-1-2-4-10(9)16(13)29)25-18-26-17(19(22,23)24)27-28(15)18/h1-7,15H,(H,25,26,27)/t15-/m1/s1 |
| InChIKey | RZYOLVDVNATONR-OAHLLOKOSA-N |
| XLogP | 5.23 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.21 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |