C21H15Cl2N3O3 — CID 78223299
2-(2,4-dichlorophenyl)-7-methyl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,6,17-trione (PubChem CID 78223299) has the molecular formula C21H15Cl2N3O3 and a molecular weight of 428.28 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-7-methyl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,6,17-trione.
| Compound Name | 2-(2,4-dichlorophenyl)-7-methyl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,6,17-trione |
|---|---|
| PubChem CID | 78223299 |
| Molecular Formula | C21H15Cl2N3O3 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-7-methyl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,6,17-trione |
| SMILES | CN1C(=O)NC(=O)C2C(c3ccc(Cl)cc3Cl)C3=C(NC21)c1ccccc1C3=O |
| InChI | InChI=1S/C21H15Cl2N3O3/c1-26-19-16(20(28)25-21(26)29)14(12-7-6-9(22)8-13(12)23)15-17(24-19)10-4-2-3-5-11(10)18(15)27/h2-8,14,16,19,24H,1H3,(H,25,28,29) |
| InChIKey | PEYVGQLHSCXAPB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |