About 3-cyclohexyl-2-(2,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one
3-cyclohexyl-2-(2,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 2927326) has the molecular formula C20H20Cl2N2O
and a molecular weight of 375.30 g/mol. Its IUPAC name is 3-cyclohexyl-2-(2,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one.
Molecular Properties
| Compound Name | 3-cyclohexyl-2-(2,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one |
| PubChem CID | 2927326 |
| Molecular Formula | C20H20Cl2N2O |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 3-cyclohexyl-2-(2,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2NC(c2ccc(Cl)cc2Cl)N1C1CCCCC1 |
| InChI | InChI=1S/C20H20Cl2N2O/c21-13-10-11-15(17(22)12-13)19-23-18-9-5-4-8-16(18)20(25)24(19)14-6-2-1-3-7-14/h4-5,8-12,14,19,23H,1-3,6-7H2 |
| InChIKey | FNHUNCKPPUDQBN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexyl-2-(2,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-2-(2,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one?
The IUPAC name of 3-cyclohexyl-2-(2,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one (CID 2927326) is 3-cyclohexyl-2-(2,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one.
What is the SMILES notation for 3-cyclohexyl-2-(2,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one?
The canonical SMILES for 3-cyclohexyl-2-(2,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one is O=C1c2ccccc2NC(c2ccc(Cl)cc2Cl)N1C1CCCCC1.
What is the InChIKey of 3-cyclohexyl-2-(2,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one?
The InChIKey is FNHUNCKPPUDQBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20Cl2N2O/c21-13-10-11-15(17(22)12-13)19-23-18-9-5-4-8-16(18)20(25)24(19)14-6-2-1-3-7-14/h4-5,8-12,14,19,23H,1-3,6-7H2.
What are the key properties of 3-cyclohexyl-2-(2,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one?
3-cyclohexyl-2-(2,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one has a molecular weight of 375.30 g/mol, XLogP of 5.89, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-2-(2,4-dichlorophenyl)-1,2-dihydroquinazolin-4-one is sourced from PubChem (CID 2927326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).