C20H22N2O3S — CID 2788313
butyl 3-[(3-methylbenzoyl)carbamothioylamino]benzoate (PubChem CID 2788313) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is butyl 3-[(3-methylbenzoyl)carbamothioylamino]benzoate.
| Compound Name | butyl 3-[(3-methylbenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 2788313 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | butyl 3-[(3-methylbenzoyl)carbamothioylamino]benzoate |
| SMILES | CCCCOC(=O)c1cccc(NC(=S)NC(=O)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C20H22N2O3S/c1-3-4-11-25-19(24)16-9-6-10-17(13-16)21-20(26)22-18(23)15-8-5-7-14(2)12-15/h5-10,12-13H,3-4,11H2,1-2H3,(H2,21,22,23,26) |
| InChIKey | GGJMRIUAJRCRQD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|