C21H24N2O3S — CID 19187871
butyl 3-(3-phenylpropanoylcarbamothioylamino)benzoate (PubChem CID 19187871) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is butyl 3-(3-phenylpropanoylcarbamothioylamino)benzoate.
| Compound Name | butyl 3-(3-phenylpropanoylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 19187871 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | butyl 3-(3-phenylpropanoylcarbamothioylamino)benzoate |
| SMILES | CCCCOC(=O)c1cccc(NC(=S)NC(=O)CCc2ccccc2)c1 |
| InChI | InChI=1S/C21H24N2O3S/c1-2-3-14-26-20(25)17-10-7-11-18(15-17)22-21(27)23-19(24)13-12-16-8-5-4-6-9-16/h4-11,15H,2-3,12-14H2,1H3,(H2,22,23,24,27) |
| InChIKey | RMMLTHACNPRFCV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|