C15H12N2O5 — CID 2788382
N-(4-nitrophenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 2788382) has the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. Its IUPAC name is N-(4-nitrophenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-(4-nitrophenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 2788382 |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N-(4-nitrophenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)C1COc2ccccc2O1 |
| InChI | InChI=1S/C15H12N2O5/c18-15(16-10-5-7-11(8-6-10)17(19)20)14-9-21-12-3-1-2-4-13(12)22-14/h1-8,14H,9H2,(H,16,18) |
| InChIKey | LPEHHYLEPCTAHH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|