C15H12FNO3 — CID 2788330
N-(4-fluorophenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 2788330) has the molecular formula C15H12FNO3 and a molecular weight of 273.26 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 2788330 |
| Molecular Formula | C15H12FNO3 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | N-(4-fluorophenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C1COc2ccccc2O1 |
| InChI | InChI=1S/C15H12FNO3/c16-10-5-7-11(8-6-10)17-15(18)14-9-19-12-3-1-2-4-13(12)20-14/h1-8,14H,9H2,(H,17,18) |
| InChIKey | QMLPLBJSVIAAKJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |