C28H30N2O6 — CID 27904457
[3-[(3aS,5R,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl] (3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 27904457) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is [3-[(3aS,5R,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl] (3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [3-[(3aS,5R,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl] (3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 27904457 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | [3-[(3aS,5R,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl] (3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOc1ccc(N2C[C@@H](C(=O)Oc3cccc(N4C(=O)[C@H]5CC[C@@H](C)C[C@@H]5C4=O)c3)CC2=O)cc1 |
| InChI | InChI=1S/C28H30N2O6/c1-3-35-21-10-8-19(9-11-21)29-16-18(14-25(29)31)28(34)36-22-6-4-5-20(15-22)30-26(32)23-12-7-17(2)13-24(23)27(30)33/h4-6,8-11,15,17-18,23-24H,3,7,12-14,16H2,1-2H3/t17-,18+,23+,24+/m1/s1 |
| InChIKey | TUZCWSSTLFAZAL-MBPAZGTNSA-N |
| XLogP | 3.97 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|