C26H25ClN2O5 — CID 27904476
[4-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-methylphenyl] (3S)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 27904476) has the molecular formula C26H25ClN2O5 and a molecular weight of 480.95 g/mol. Its IUPAC name is [4-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-methylphenyl] (3S)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [4-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-methylphenyl] (3S)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 27904476 |
| Molecular Formula | C26H25ClN2O5 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | [4-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-methylphenyl] (3S)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1cc(OC(=O)[C@H]2CC(=O)N(c3ccc(Cl)cc3)C2)ccc1N1C(=O)[C@H]2CCCC[C@@H]2C1=O |
| InChI | InChI=1S/C26H25ClN2O5/c1-15-12-19(10-11-22(15)29-24(31)20-4-2-3-5-21(20)25(29)32)34-26(33)16-13-23(30)28(14-16)18-8-6-17(27)7-9-18/h6-12,16,20-21H,2-5,13-14H2,1H3/t16-,20-,21-/m0/s1 |
| InChIKey | DAKLRVIWORURDB-NDXORKPFSA-N |
| XLogP | 4.29 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|