About 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride
2-(3,5-dimethylphenoxy)ethanamine;hydrochloride (PubChem CID 2790509) has the molecular formula C10H16ClNO
and a molecular weight of 201.70 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride |
| PubChem CID | 2790509 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride |
| SMILES | Cc1cc(C)cc(OCCN)c1.Cl |
| InChI | InChI=1S/C10H15NO.ClH/c1-8-5-9(2)7-10(6-8)12-4-3-11;/h5-7H,3-4,11H2,1-2H3;1H |
| InChIKey | GSRVMJWPWQIUEM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride?
The IUPAC name of 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride (CID 2790509) is 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride.
What is the SMILES notation for 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride?
The canonical SMILES for 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride is Cc1cc(C)cc(OCCN)c1.Cl.
What is the InChIKey of 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride?
The InChIKey is GSRVMJWPWQIUEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO.ClH/c1-8-5-9(2)7-10(6-8)12-4-3-11;/h5-7H,3-4,11H2,1-2H3;1H.
What are the key properties of 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride?
2-(3,5-dimethylphenoxy)ethanamine;hydrochloride has a molecular weight of 201.70 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride is sourced from PubChem (CID 2790509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).