C10H16ClNO — CID 2790509
2-(3,5-dimethylphenoxy)ethanamine;hydrochloride (PubChem CID 2790509) has the molecular formula C10H16ClNO and a molecular weight of 201.70 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride.
| Compound Name | 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 2790509 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)ethanamine;hydrochloride |
| SMILES | Cc1cc(C)cc(OCCN)c1.Cl |
| InChI | InChI=1S/C10H15NO.ClH/c1-8-5-9(2)7-10(6-8)12-4-3-11;/h5-7H,3-4,11H2,1-2H3;1H |
| InChIKey | GSRVMJWPWQIUEM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |