C16H14ClNO5S — CID 27911248
[(2R)-1-(3-chlorophenyl)-1-oxopropan-2-yl] 4-sulfamoylbenzoate (PubChem CID 27911248) has the molecular formula C16H14ClNO5S and a molecular weight of 367.81 g/mol. Its IUPAC name is [(2R)-1-(3-chlorophenyl)-1-oxopropan-2-yl] 4-sulfamoylbenzoate.
| Compound Name | [(2R)-1-(3-chlorophenyl)-1-oxopropan-2-yl] 4-sulfamoylbenzoate |
|---|---|
| PubChem CID | 27911248 |
| Molecular Formula | C16H14ClNO5S |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | [(2R)-1-(3-chlorophenyl)-1-oxopropan-2-yl] 4-sulfamoylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(S(N)(=O)=O)cc1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14ClNO5S/c1-10(15(19)12-3-2-4-13(17)9-12)23-16(20)11-5-7-14(8-6-11)24(18,21)22/h2-10H,1H3,(H2,18,21,22)/t10-/m1/s1 |
| InChIKey | YZLOYHHMXVLCLT-SNVBAGLBSA-N |
| XLogP | 2.42 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |