C16H13ClO5 — CID 41476323
[(2S)-1-(3-chlorophenyl)-1-oxopropan-2-yl] 2,4-dihydroxybenzoate (PubChem CID 41476323) has the molecular formula C16H13ClO5 and a molecular weight of 320.73 g/mol. Its IUPAC name is [(2S)-1-(3-chlorophenyl)-1-oxopropan-2-yl] 2,4-dihydroxybenzoate.
| Compound Name | [(2S)-1-(3-chlorophenyl)-1-oxopropan-2-yl] 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 41476323 |
| Molecular Formula | C16H13ClO5 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | [(2S)-1-(3-chlorophenyl)-1-oxopropan-2-yl] 2,4-dihydroxybenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(O)cc1O)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H13ClO5/c1-9(15(20)10-3-2-4-11(17)7-10)22-16(21)13-6-5-12(18)8-14(13)19/h2-9,18-19H,1H3/t9-/m0/s1 |
| InChIKey | KEUVPYHXGDZDGA-VIFPVBQESA-N |
| XLogP | 3.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |