C17H22N2O2S2 — CID 2792027
butyl 2-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetate (PubChem CID 2792027) has the molecular formula C17H22N2O2S2 and a molecular weight of 350.51 g/mol. Its IUPAC name is butyl 2-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetate.
| Compound Name | butyl 2-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 2792027 |
| Molecular Formula | C17H22N2O2S2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | butyl 2-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetate |
| SMILES | CCCCOC(=O)CSc1ncnc2sc3c(c12)CCC(C)C3 |
| InChI | InChI=1S/C17H22N2O2S2/c1-3-4-7-21-14(20)9-22-16-15-12-6-5-11(2)8-13(12)23-17(15)19-10-18-16/h10-11H,3-9H2,1-2H3 |
| InChIKey | YXZYQJPOIUSUQE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|