C20H21ClN2OS2 — CID 44639743
4-[3-(4-chlorophenoxy)propylsulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (PubChem CID 44639743) has the molecular formula C20H21ClN2OS2 and a molecular weight of 404.99 g/mol. Its IUPAC name is 4-[3-(4-chlorophenoxy)propylsulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine.
| Compound Name | 4-[3-(4-chlorophenoxy)propylsulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 44639743 |
| Molecular Formula | C20H21ClN2OS2 |
| Molecular Weight | 404.99 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 4-[3-(4-chlorophenoxy)propylsulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| SMILES | CC1CCc2c(sc3ncnc(SCCCOc4ccc(Cl)cc4)c23)C1 |
| InChI | InChI=1S/C20H21ClN2OS2/c1-13-3-8-16-17(11-13)26-20-18(16)19(22-12-23-20)25-10-2-9-24-15-6-4-14(21)5-7-15/h4-7,12-13H,2-3,8-11H2,1H3 |
| InChIKey | IFMFQHRZABVOGO-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.99 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|