C19H19BrN2OS2 — CID 2470793
(7S)-4-[2-(3-bromophenoxy)ethylsulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (PubChem CID 2470793) has the molecular formula C19H19BrN2OS2 and a molecular weight of 435.41 g/mol. Its IUPAC name is (7S)-4-[2-(3-bromophenoxy)ethylsulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine.
| Compound Name | (7S)-4-[2-(3-bromophenoxy)ethylsulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 2470793 |
| Molecular Formula | C19H19BrN2OS2 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | (7S)-4-[2-(3-bromophenoxy)ethylsulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| SMILES | C[C@H]1CCc2c(sc3ncnc(SCCOc4cccc(Br)c4)c23)C1 |
| InChI | InChI=1S/C19H19BrN2OS2/c1-12-5-6-15-16(9-12)25-19-17(15)18(21-11-22-19)24-8-7-23-14-4-2-3-13(20)10-14/h2-4,10-12H,5-9H2,1H3/t12-/m0/s1 |
| InChIKey | WSSFUYJBYCCGLL-LBPRGKRZSA-N |
| XLogP | 5.75 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|