C20H24N4O10 — CID 27922681
bis[(5-ethoxycarbonyl-2-oxo-3,4-dihydro-1H-pyrimidin-6-yl)methyl] (E)-but-2-enedioate (PubChem CID 27922681) has the molecular formula C20H24N4O10 and a molecular weight of 480.43 g/mol. Its IUPAC name is bis[(5-ethoxycarbonyl-2-oxo-3,4-dihydro-1H-pyrimidin-6-yl)methyl] (E)-but-2-enedioate.
| Compound Name | bis[(5-ethoxycarbonyl-2-oxo-3,4-dihydro-1H-pyrimidin-6-yl)methyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 27922681 |
| Molecular Formula | C20H24N4O10 |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | bis[(5-ethoxycarbonyl-2-oxo-3,4-dihydro-1H-pyrimidin-6-yl)methyl] (E)-but-2-enedioate |
| SMILES | CCOC(=O)C1=C(COC(=O)/C=C/C(=O)OCC2=C(C(=O)OCC)CNC(=O)N2)NC(=O)NC1 |
| InChI | InChI=1S/C20H24N4O10/c1-3-31-17(27)11-7-21-19(29)23-13(11)9-33-15(25)5-6-16(26)34-10-14-12(18(28)32-4-2)8-22-20(30)24-14/h5-6H,3-4,7-10H2,1-2H3,(H2,21,23,29)(H2,22,24,30)/b6-5+ |
| InChIKey | FHPXQSCGXPUVHF-AATRIKPKSA-N |
| XLogP | -1.11 |
| TPSA | 187.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|