C17H16Cl2N2O5 — CID 27920760
ethyl 6-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 27920760) has the molecular formula C17H16Cl2N2O5 and a molecular weight of 399.23 g/mol. Its IUPAC name is ethyl 6-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 27920760 |
| Molecular Formula | C17H16Cl2N2O5 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | ethyl 6-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(COC(=O)/C=C/c2ccc(Cl)c(Cl)c2)NC(=O)NC1 |
| InChI | InChI=1S/C17H16Cl2N2O5/c1-2-25-16(23)11-8-20-17(24)21-14(11)9-26-15(22)6-4-10-3-5-12(18)13(19)7-10/h3-7H,2,8-9H2,1H3,(H2,20,21,24)/b6-4+ |
| InChIKey | KZHRVKRUVDZAQC-GQCTYLIASA-N |
| XLogP | 2.68 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|