C23H22BrNO5S — CID 2793656
ethyl 3-[4-[2-(5-bromo-2-methylphenyl)sulfanylacetyl]oxy-3-ethoxyphenyl]-2-cyanoprop-2-enoate (PubChem CID 2793656) has the molecular formula C23H22BrNO5S and a molecular weight of 504.40 g/mol. Its IUPAC name is ethyl 3-[4-[2-(5-bromo-2-methylphenyl)sulfanylacetyl]oxy-3-ethoxyphenyl]-2-cyanoprop-2-enoate.
| Compound Name | ethyl 3-[4-[2-(5-bromo-2-methylphenyl)sulfanylacetyl]oxy-3-ethoxyphenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 2793656 |
| Molecular Formula | C23H22BrNO5S |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | ethyl 3-[4-[2-(5-bromo-2-methylphenyl)sulfanylacetyl]oxy-3-ethoxyphenyl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1ccc(OC(=O)CSc2cc(Br)ccc2C)c(OCC)c1 |
| InChI | InChI=1S/C23H22BrNO5S/c1-4-28-20-11-16(10-17(13-25)23(27)29-5-2)7-9-19(20)30-22(26)14-31-21-12-18(24)8-6-15(21)3/h6-12H,4-5,14H2,1-3H3 |
| InChIKey | XMLKYUDYHRYAMB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|