C23H20N2O5S — CID 27937229
2-(1,3-dioxoisoindol-2-yl)ethyl 4-methyl-2-[(4-methylphenoxy)methyl]-1,3-thiazole-5-carboxylate (PubChem CID 27937229) has the molecular formula C23H20N2O5S and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 4-methyl-2-[(4-methylphenoxy)methyl]-1,3-thiazole-5-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-methyl-2-[(4-methylphenoxy)methyl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 27937229 |
| Molecular Formula | C23H20N2O5S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-methyl-2-[(4-methylphenoxy)methyl]-1,3-thiazole-5-carboxylate |
| SMILES | Cc1ccc(OCc2nc(C)c(C(=O)OCCN3C(=O)c4ccccc4C3=O)s2)cc1 |
| InChI | InChI=1S/C23H20N2O5S/c1-14-7-9-16(10-8-14)30-13-19-24-15(2)20(31-19)23(28)29-12-11-25-21(26)17-5-3-4-6-18(17)22(25)27/h3-10H,11-13H2,1-2H3 |
| InChIKey | IBLSRXUBEUJIOH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|