C20H16N2O4S2 — CID 33116781
3-(1,3-dioxoisoindol-2-yl)propyl 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate (PubChem CID 33116781) has the molecular formula C20H16N2O4S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 33116781 |
| Molecular Formula | C20H16N2O4S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2ccsc2)sc1C(=O)OCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H16N2O4S2/c1-12-16(28-17(21-12)13-7-10-27-11-13)20(25)26-9-4-8-22-18(23)14-5-2-3-6-15(14)19(22)24/h2-3,5-7,10-11H,4,8-9H2,1H3 |
| InChIKey | SQKYRVIXMGICQT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|