C14H21N5O2S — CID 27965834
2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-pentylacetamide (PubChem CID 27965834) has the molecular formula C14H21N5O2S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-pentylacetamide.
| Compound Name | 2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-pentylacetamide |
|---|---|
| PubChem CID | 27965834 |
| Molecular Formula | C14H21N5O2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CSc1nnc(-c2ccoc2C)n1N |
| InChI | InChI=1S/C14H21N5O2S/c1-3-4-5-7-16-12(20)9-22-14-18-17-13(19(14)15)11-6-8-21-10(11)2/h6,8H,3-5,7,9,15H2,1-2H3,(H,16,20) |
| InChIKey | HEJDRYCAAQZMJQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|