C15H23N5O2S — CID 78812625
2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide (PubChem CID 78812625) has the molecular formula C15H23N5O2S and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide.
| Compound Name | 2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide |
|---|---|
| PubChem CID | 78812625 |
| Molecular Formula | C15H23N5O2S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide |
| SMILES | CCCCCCNC(=O)CSc1nnc(-c2ccoc2C)n1N |
| InChI | InChI=1S/C15H23N5O2S/c1-3-4-5-6-8-17-13(21)10-23-15-19-18-14(20(15)16)12-7-9-22-11(12)2/h7,9H,3-6,8,10,16H2,1-2H3,(H,17,21) |
| InChIKey | ZVYMZZHYVDEIMX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|