C16H22ClN2O3PS2 — CID 2799098
N-[[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methylsulfanyl-ethoxyphosphoryl]propan-2-amine (PubChem CID 2799098) has the molecular formula C16H22ClN2O3PS2 and a molecular weight of 420.92 g/mol. Its IUPAC name is N-[[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methylsulfanyl-ethoxyphosphoryl]propan-2-amine.
| Compound Name | N-[[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methylsulfanyl-ethoxyphosphoryl]propan-2-amine |
|---|---|
| PubChem CID | 2799098 |
| Molecular Formula | C16H22ClN2O3PS2 |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | N-[[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methylsulfanyl-ethoxyphosphoryl]propan-2-amine |
| SMILES | CCOP(=O)(NC(C)C)SCc1csc(COc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H22ClN2O3PS2/c1-4-22-23(20,19-12(2)3)25-11-14-10-24-16(18-14)9-21-15-7-5-13(17)6-8-15/h5-8,10,12H,4,9,11H2,1-3H3,(H,19,20) |
| InChIKey | WOHBFPGZJPAZLH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|