C15H21ClN3O4PS — CID 2799067
N-[[3-[(4-chlorophenoxy)methyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl-ethoxyphosphoryl]propan-2-amine (PubChem CID 2799067) has the molecular formula C15H21ClN3O4PS and a molecular weight of 405.84 g/mol. Its IUPAC name is N-[[3-[(4-chlorophenoxy)methyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl-ethoxyphosphoryl]propan-2-amine.
| Compound Name | N-[[3-[(4-chlorophenoxy)methyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl-ethoxyphosphoryl]propan-2-amine |
|---|---|
| PubChem CID | 2799067 |
| Molecular Formula | C15H21ClN3O4PS |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | N-[[3-[(4-chlorophenoxy)methyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl-ethoxyphosphoryl]propan-2-amine |
| SMILES | CCOP(=O)(NC(C)C)SCc1nc(COc2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C15H21ClN3O4PS/c1-4-22-24(20,19-11(2)3)25-10-15-17-14(18-23-15)9-21-13-7-5-12(16)6-8-13/h5-8,11H,4,9-10H2,1-3H3,(H,19,20) |
| InChIKey | WMLDEFMTLLCFJF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|